C13H15Cl2NO3S — CID 141256695
[(2R,3R)-5-(dichloromethyl)-2-(4-methylsulfonylphenyl)-2,3-dihydro-1H-pyrrol-3-yl]methanol (PubChem CID 141256695) has the molecular formula C13H15Cl2NO3S and a molecular weight of 336.24 g/mol. Its IUPAC name is [(2R,3R)-5-(dichloromethyl)-2-(4-methylsulfonylphenyl)-2,3-dihydro-1H-pyrrol-3-yl]methanol.
| Compound Name | [(2R,3R)-5-(dichloromethyl)-2-(4-methylsulfonylphenyl)-2,3-dihydro-1H-pyrrol-3-yl]methanol |
|---|---|
| PubChem CID | 141256695 |
| Molecular Formula | C13H15Cl2NO3S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | [(2R,3R)-5-(dichloromethyl)-2-(4-methylsulfonylphenyl)-2,3-dihydro-1H-pyrrol-3-yl]methanol |
| SMILES | CS(=O)(=O)c1ccc([C@@H]2NC(C(Cl)Cl)=C[C@H]2CO)cc1 |
| InChI | InChI=1S/C13H15Cl2NO3S/c1-20(18,19)10-4-2-8(3-5-10)12-9(7-17)6-11(16-12)13(14)15/h2-6,9,12-13,16-17H,7H2,1H3/t9-,12-/m0/s1 |
| InChIKey | OAYRVZHYNSZEHL-CABZTGNLSA-N |
| XLogP | 2.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|