C12H15Cl2NO4S — CID 174949074
2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-ol;methane (PubChem CID 174949074) has the molecular formula C12H15Cl2NO4S and a molecular weight of 340.23 g/mol. Its IUPAC name is 2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-ol;methane.
| Compound Name | 2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-ol;methane |
|---|---|
| PubChem CID | 174949074 |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 2-(dichloromethyl)-5-(4-methylsulfonylphenyl)-4,5-dihydro-1,3-oxazol-4-ol;methane |
| SMILES | C.CS(=O)(=O)c1ccc(C2OC(C(Cl)Cl)=NC2O)cc1 |
| InChI | InChI=1S/C11H11Cl2NO4S.CH4/c1-19(16,17)7-4-2-6(3-5-7)8-10(15)14-11(18-8)9(12)13;/h2-5,8-10,15H,1H3;1H4 |
| InChIKey | QRLKUHJYGYUFMK-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|