About 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole
2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole (PubChem CID 141258345) has the molecular formula C27H25ClF2N2S
and a molecular weight of 483.03 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole |
| PubChem CID | 141258345 |
| Molecular Formula | C27H25ClF2N2S |
| Molecular Weight | 483.03 g/mol |
| Exact Mass | 482.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole |
| SMILES | Fc1cc2nc(-c3ccc(Cl)cc3)n(C(CSc3ccccc3)C3CCCCC3)c2cc1F |
| InChI | InChI=1S/C27H25ClF2N2S/c28-20-13-11-19(12-14-20)27-31-24-15-22(29)23(30)16-25(24)32(27)26(18-7-3-1-4-8-18)17-33-21-9-5-2-6-10-21/h2,5-6,9-16,18,26H,1,3-4,7-8,17H2 |
| InChIKey | YFTBJKMBQXNSRJ-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.03 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole?
The IUPAC name of 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole (CID 141258345) is 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole.
What is the SMILES notation for 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole?
The canonical SMILES for 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole is Fc1cc2nc(-c3ccc(Cl)cc3)n(C(CSc3ccccc3)C3CCCCC3)c2cc1F.
What is the InChIKey of 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole?
The InChIKey is YFTBJKMBQXNSRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25ClF2N2S/c28-20-13-11-19(12-14-20)27-31-24-15-22(29)23(30)16-25(24)32(27)26(18-7-3-1-4-8-18)17-33-21-9-5-2-6-10-21/h2,5-6,9-16,18,26H,1,3-4,7-8,17H2.
What are the key properties of 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole?
2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole has a molecular weight of 483.03 g/mol, XLogP of 8.55, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-(1-cyclohexyl-2-phenylsulfanylethyl)-5,6-difluorobenzimidazole is sourced from PubChem (CID 141258345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).