About 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol
2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol (PubChem CID 66619310) has the molecular formula C21H21ClF2N2O
and a molecular weight of 390.86 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol.
Molecular Properties
| Compound Name | 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol |
| PubChem CID | 66619310 |
| Molecular Formula | C21H21ClF2N2O |
| Molecular Weight | 390.86 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol |
| SMILES | OCC(C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C21H21ClF2N2O/c22-15-8-6-14(7-9-15)21-25-18-10-16(23)17(24)11-19(18)26(21)20(12-27)13-4-2-1-3-5-13/h6-11,13,20,27H,1-5,12H2 |
| InChIKey | BBFCJQNDZOKFSI-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.86 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol?
The IUPAC name of 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol (CID 66619310) is 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol.
What is the SMILES notation for 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol?
The canonical SMILES for 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol is OCC(C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21.
What is the InChIKey of 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol?
The InChIKey is BBFCJQNDZOKFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClF2N2O/c22-15-8-6-14(7-9-15)21-25-18-10-16(23)17(24)11-19(18)26(21)20(12-27)13-4-2-1-3-5-13/h6-11,13,20,27H,1-5,12H2.
What are the key properties of 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol?
2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol has a molecular weight of 390.86 g/mol, XLogP of 5.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylethanol is sourced from PubChem (CID 66619310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).