C12H6N2O6RuS2 — CID 141259739
1,10-phenanthroline-2,3-disulfonate;ruthenium(2+) (PubChem CID 141259739) has the molecular formula C12H6N2O6RuS2 and a molecular weight of 439.39 g/mol. Its IUPAC name is 1,10-phenanthroline-2,3-disulfonate;ruthenium(2+).
| Compound Name | 1,10-phenanthroline-2,3-disulfonate;ruthenium(2+) |
|---|---|
| PubChem CID | 141259739 |
| Molecular Formula | C12H6N2O6RuS2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.87 |
| IUPAC Name | 1,10-phenanthroline-2,3-disulfonate;ruthenium(2+) |
| SMILES | O=S(=O)([O-])c1cc2ccc3cccnc3c2nc1S(=O)(=O)[O-].[Ru+2] |
| InChI | InChI=1S/C12H8N2O6S2.Ru/c15-21(16,17)9-6-8-4-3-7-2-1-5-13-10(7)11(8)14-12(9)22(18,19)20;/h1-6H,(H,15,16,17)(H,18,19,20);/q;+2/p-2 |
| InChIKey | ZOAHIIBXLKQQHS-UHFFFAOYSA-L |
| XLogP | 0.59 |
| TPSA | 140.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|