C19H21F6N3O2 — CID 141260455
tert-butyl N-[4-(1,1,1,3,3,3-hexafluoro-2-pyrazol-1-ylpropan-2-yl)-2,6-dimethylphenyl]carbamate (PubChem CID 141260455) has the molecular formula C19H21F6N3O2 and a molecular weight of 437.38 g/mol. Its IUPAC name is tert-butyl N-[4-(1,1,1,3,3,3-hexafluoro-2-pyrazol-1-ylpropan-2-yl)-2,6-dimethylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-(1,1,1,3,3,3-hexafluoro-2-pyrazol-1-ylpropan-2-yl)-2,6-dimethylphenyl]carbamate |
|---|---|
| PubChem CID | 141260455 |
| Molecular Formula | C19H21F6N3O2 |
| Molecular Weight | 437.38 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | tert-butyl N-[4-(1,1,1,3,3,3-hexafluoro-2-pyrazol-1-ylpropan-2-yl)-2,6-dimethylphenyl]carbamate |
| SMILES | Cc1cc(C(n2cccn2)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H21F6N3O2/c1-11-9-13(10-12(2)14(11)27-15(29)30-16(3,4)5)17(18(20,21)22,19(23,24)25)28-8-6-7-26-28/h6-10H,1-5H3,(H,27,29) |
| InChIKey | NJVKEZDLQDIFRC-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.38 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |