C42H75NO2 — CID 141261065
1-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxol-4-yl]-N,N-dimethylmethanamine (PubChem CID 141261065) has the molecular formula C42H75NO2 and a molecular weight of 626.07 g/mol. Its IUPAC name is 1-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxol-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxol-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 141261065 |
| Molecular Formula | C42H75NO2 |
| Molecular Weight | 626.07 g/mol |
| Exact Mass | 625.58 |
| IUPAC Name | 1-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxol-4-yl]-N,N-dimethylmethanamine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(CCCCCCCC/C=C\C/C=C\CCCCC)OC=C(CN(C)C)O1 |
| InChI | InChI=1S/C42H75NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(44-40-41(45-42)39-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,40H,5-12,17-18,23-39H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VNEOYMQTDWWIAX-KWXKLSQISA-N |
| XLogP | 13.54 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.07 |
| LogP ≤ 5 | 13.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|