C12H14F2N2O2 — CID 141264582
2-[5-(2,2-difluoroethenyl)-2-oxo-3H-azepin-1-yl]butanamide (PubChem CID 141264582) has the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. Its IUPAC name is 2-[5-(2,2-difluoroethenyl)-2-oxo-3H-azepin-1-yl]butanamide.
| Compound Name | 2-[5-(2,2-difluoroethenyl)-2-oxo-3H-azepin-1-yl]butanamide |
|---|---|
| PubChem CID | 141264582 |
| Molecular Formula | C12H14F2N2O2 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[5-(2,2-difluoroethenyl)-2-oxo-3H-azepin-1-yl]butanamide |
| SMILES | CCC(C(N)=O)N1C=CC(C=C(F)F)=CCC1=O |
| InChI | InChI=1S/C12H14F2N2O2/c1-2-9(12(15)18)16-6-5-8(7-10(13)14)3-4-11(16)17/h3,5-7,9H,2,4H2,1H3,(H2,15,18) |
| InChIKey | IYVLXGIRJGEPLW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |