C17H24N2O4 — CID 141265672
3,5-diamino-2-(6-prop-2-enoyloxyheptyl)benzoic acid (PubChem CID 141265672) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3,5-diamino-2-(6-prop-2-enoyloxyheptyl)benzoic acid.
| Compound Name | 3,5-diamino-2-(6-prop-2-enoyloxyheptyl)benzoic acid |
|---|---|
| PubChem CID | 141265672 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 3,5-diamino-2-(6-prop-2-enoyloxyheptyl)benzoic acid |
| SMILES | C=CC(=O)OC(C)CCCCCc1c(N)cc(N)cc1C(=O)O |
| InChI | InChI=1S/C17H24N2O4/c1-3-16(20)23-11(2)7-5-4-6-8-13-14(17(21)22)9-12(18)10-15(13)19/h3,9-11H,1,4-8,18-19H2,2H3,(H,21,22) |
| InChIKey | SLFCYFGMOFPPMU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|