C22H19ClN2O3 — CID 141265929
2-benzyl-4-[[5-(2-chlorophenyl)-2-pyridinyl]amino]-4-oxobutanoic acid (PubChem CID 141265929) has the molecular formula C22H19ClN2O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 2-benzyl-4-[[5-(2-chlorophenyl)-2-pyridinyl]amino]-4-oxobutanoic acid.
| Compound Name | 2-benzyl-4-[[5-(2-chlorophenyl)-2-pyridinyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 141265929 |
| Molecular Formula | C22H19ClN2O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | 2-benzyl-4-[[5-(2-chlorophenyl)-2-pyridinyl]amino]-4-oxobutanoic acid |
| SMILES | O=C(CC(Cc1ccccc1)C(=O)O)Nc1ccc(-c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C22H19ClN2O3/c23-19-9-5-4-8-18(19)16-10-11-20(24-14-16)25-21(26)13-17(22(27)28)12-15-6-2-1-3-7-15/h1-11,14,17H,12-13H2,(H,27,28)(H,24,25,26) |
| InChIKey | GDOLEOVRVKNPFM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |