C14H12O6S2 — CID 141266304
4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-yl]benzoic acid (PubChem CID 141266304) has the molecular formula C14H12O6S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-yl]benzoic acid.
| Compound Name | 4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 141266304 |
| Molecular Formula | C14H12O6S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 4-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-yl]benzoic acid |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(c2ccc(C(=O)O)cc2)S1 |
| InChI | InChI=1S/C14H12O6S2/c1-19-12(17)9-10(13(18)20-2)22-14(21-9)8-5-3-7(4-6-8)11(15)16/h3-6,14H,1-2H3,(H,15,16) |
| InChIKey | MZXIEHHUANGHHT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |