C9H12N2O — CID 14126679
1,3-dimethyl-6,7-dihydro-5H-indazol-4-one (PubChem CID 14126679) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1,3-dimethyl-6,7-dihydro-5H-indazol-4-one.
| Compound Name | 1,3-dimethyl-6,7-dihydro-5H-indazol-4-one |
|---|---|
| PubChem CID | 14126679 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,3-dimethyl-6,7-dihydro-5H-indazol-4-one |
| SMILES | Cc1nn(C)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C9H12N2O/c1-6-9-7(11(2)10-6)4-3-5-8(9)12/h3-5H2,1-2H3 |
| InChIKey | KVIYWNOWYQFRMF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |