C12H12N6O2 — CID 141267410
ethyl 4-amino-5-cyano-2-methyl-6-(2H-triazol-4-yl)pyridine-3-carboxylate (PubChem CID 141267410) has the molecular formula C12H12N6O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is ethyl 4-amino-5-cyano-2-methyl-6-(2H-triazol-4-yl)pyridine-3-carboxylate.
| Compound Name | ethyl 4-amino-5-cyano-2-methyl-6-(2H-triazol-4-yl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 141267410 |
| Molecular Formula | C12H12N6O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | ethyl 4-amino-5-cyano-2-methyl-6-(2H-triazol-4-yl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc(-c2cn[nH]n2)c(C#N)c1N |
| InChI | InChI=1S/C12H12N6O2/c1-3-20-12(19)9-6(2)16-11(7(4-13)10(9)14)8-5-15-18-17-8/h5H,3H2,1-2H3,(H2,14,16)(H,15,17,18) |
| InChIKey | METSQKDYPGYWPM-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |