C10H12ClN5 — CID 141267684
5-chloro-2-N-(2,5-dimethylpyrazol-3-yl)pyridine-2,4-diamine (PubChem CID 141267684) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 5-chloro-2-N-(2,5-dimethylpyrazol-3-yl)pyridine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(2,5-dimethylpyrazol-3-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 141267684 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 5-chloro-2-N-(2,5-dimethylpyrazol-3-yl)pyridine-2,4-diamine |
| SMILES | Cc1cc(Nc2cc(N)c(Cl)cn2)n(C)n1 |
| InChI | InChI=1S/C10H12ClN5/c1-6-3-10(16(2)15-6)14-9-4-8(12)7(11)5-13-9/h3-5H,1-2H3,(H3,12,13,14) |
| InChIKey | TVNUWQOKTVAERB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |