C11H15F3N2 — CID 141267751
3,4-dimethyl-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 141267751) has the molecular formula C11H15F3N2 and a molecular weight of 232.25 g/mol. Its IUPAC name is 3,4-dimethyl-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazole.
| Compound Name | 3,4-dimethyl-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 141267751 |
| Molecular Formula | C11H15F3N2 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3,4-dimethyl-1-(2,2,2-trifluoroethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | Cc1nn(CC(F)(F)F)c2c1C(C)CCC2 |
| InChI | InChI=1S/C11H15F3N2/c1-7-4-3-5-9-10(7)8(2)15-16(9)6-11(12,13)14/h7H,3-6H2,1-2H3 |
| InChIKey | VDWNTHSYWJEFQG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |