C14H16O3S — CID 141268100
2-(benzenesulfonyl)-5-methoxy-5-methylcyclohexa-1,3-diene (PubChem CID 141268100) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-5-methoxy-5-methylcyclohexa-1,3-diene.
| Compound Name | 2-(benzenesulfonyl)-5-methoxy-5-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141268100 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-(benzenesulfonyl)-5-methoxy-5-methylcyclohexa-1,3-diene |
| SMILES | COC1(C)C=CC(S(=O)(=O)c2ccccc2)=CC1 |
| InChI | InChI=1S/C14H16O3S/c1-14(17-2)10-8-13(9-11-14)18(15,16)12-6-4-3-5-7-12/h3-10H,11H2,1-2H3 |
| InChIKey | KRDLJBBDVWVBPC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |