C9H12N2O — CID 141268233
1-methyl-4,6,7,8-tetrahydroquinazolin-5-one (PubChem CID 141268233) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-methyl-4,6,7,8-tetrahydroquinazolin-5-one.
| Compound Name | 1-methyl-4,6,7,8-tetrahydroquinazolin-5-one |
|---|---|
| PubChem CID | 141268233 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1-methyl-4,6,7,8-tetrahydroquinazolin-5-one |
| SMILES | CN1C=NCC2=C1CCCC2=O |
| InChI | InChI=1S/C9H12N2O/c1-11-6-10-5-7-8(11)3-2-4-9(7)12/h6H,2-5H2,1H3 |
| InChIKey | ZKZOXPYUTDCFKJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |