About ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one
ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one (PubChem CID 142224289) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one.
Analyze ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one?
The IUPAC name of ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one (CID 142224289) is ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one.
What is the SMILES notation for ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one?
The canonical SMILES for ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one is CC.CN1C=NCCCC1=O.
What is the InChIKey of ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one?
The InChIKey is LJKPJDSLAJFWHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.C2H6/c1-8-5-7-4-2-3-6(8)9;1-2/h5H,2-4H2,1H3;1-2H3.
What are the key properties of ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one?
ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one has a molecular weight of 156.23 g/mol, XLogP of 1.29, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methyl-5,6-dihydro-4H-1,3-diazepin-7-one is sourced from PubChem (CID 142224289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).