C19H19ClN2O2 — CID 141270018
(2R)-4-[4-(3-chlorophenyl)-3-phenyl-1H-pyrazol-5-yl]butane-1,2-diol (PubChem CID 141270018) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is (2R)-4-[4-(3-chlorophenyl)-3-phenyl-1H-pyrazol-5-yl]butane-1,2-diol.
| Compound Name | (2R)-4-[4-(3-chlorophenyl)-3-phenyl-1H-pyrazol-5-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 141270018 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R)-4-[4-(3-chlorophenyl)-3-phenyl-1H-pyrazol-5-yl]butane-1,2-diol |
| SMILES | OC[C@H](O)CCc1[nH]nc(-c2ccccc2)c1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN2O2/c20-15-8-4-7-14(11-15)18-17(10-9-16(24)12-23)21-22-19(18)13-5-2-1-3-6-13/h1-8,11,16,23-24H,9-10,12H2,(H,21,22)/t16-/m1/s1 |
| InChIKey | JAGJNBHHDBKNFS-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |