C11H8F3N3O2S — CID 141271002
2-amino-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 141271002) has the molecular formula C11H8F3N3O2S and a molecular weight of 303.27 g/mol. Its IUPAC name is 2-amino-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 141271002 |
| Molecular Formula | C11H8F3N3O2S |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-amino-N-[4-(trifluoromethoxy)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Nc1ncc(C(=O)Nc2ccc(OC(F)(F)F)cc2)s1 |
| InChI | InChI=1S/C11H8F3N3O2S/c12-11(13,14)19-7-3-1-6(2-4-7)17-9(18)8-5-16-10(15)20-8/h1-5H,(H2,15,16)(H,17,18) |
| InChIKey | ARPHHBUTNDOXQW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |