C10H17N3 — CID 141271071
6-prop-1-enyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine (PubChem CID 141271071) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 6-prop-1-enyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 6-prop-1-enyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 141271071 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 6-prop-1-enyl-3,4,6,7,8,9-hexahydro-2H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC=CC1CCNC2=NCCCN21 |
| InChI | InChI=1S/C10H17N3/c1-2-4-9-5-7-12-10-11-6-3-8-13(9)10/h2,4,9H,3,5-8H2,1H3,(H,11,12) |
| InChIKey | BCJDRPNAPKITGK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|