C15H31N5 — CID 109499144
3-[(1,4-dimethylpiperazin-2-yl)methyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109499144) has the molecular formula C15H31N5 and a molecular weight of 281.45 g/mol. Its IUPAC name is 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109499144 |
| Molecular Formula | C15H31N5 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.26 |
| IUPAC Name | 3-[(1,4-dimethylpiperazin-2-yl)methyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCC1CN(C)CCN1C |
| InChI | InChI=1S/C15H31N5/c1-6-7-8-9-20(5)15(16-2)17-12-14-13-18(3)10-11-19(14)4/h6,14H,1,7-13H2,2-5H3,(H,16,17) |
| InChIKey | ZZOKCYNPEJVVGF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|