C27H25N3O5S — CID 141272404
2-[4-[[6-(3,4-dihydroxyphenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]amino]phenyl]propane-2-sulfonic acid (PubChem CID 141272404) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is 2-[4-[[6-(3,4-dihydroxyphenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]amino]phenyl]propane-2-sulfonic acid.
| Compound Name | 2-[4-[[6-(3,4-dihydroxyphenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]amino]phenyl]propane-2-sulfonic acid |
|---|---|
| PubChem CID | 141272404 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 2-[4-[[6-(3,4-dihydroxyphenyl)-5,6-dihydrobenzo[h]quinazolin-2-yl]amino]phenyl]propane-2-sulfonic acid |
| SMILES | CC(C)(c1ccc(Nc2ncc3c(n2)-c2ccccc2C(c2ccc(O)c(O)c2)C3)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C27H25N3O5S/c1-27(2,36(33,34)35)18-8-10-19(11-9-18)29-26-28-15-17-13-22(16-7-12-23(31)24(32)14-16)20-5-3-4-6-21(20)25(17)30-26/h3-12,14-15,22,31-32H,13H2,1-2H3,(H,28,29,30)(H,33,34,35) |
| InChIKey | GUEZOROMODOMJZ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|