C37H44N6O3 — CID 59490238
2,5-diethoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide (PubChem CID 59490238) has the molecular formula C37H44N6O3 and a molecular weight of 620.80 g/mol. Its IUPAC name is 2,5-diethoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 2,5-diethoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59490238 |
| Molecular Formula | C37H44N6O3 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.35 |
| IUPAC Name | 2,5-diethoxy-N-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
| SMILES | CCOc1ccc(OCC)c(C(=O)Nc2ccc(C3Cc4cnc(NCCCN5CCN(C)CC5)nc4-c4ccccc43)cc2)c1 |
| InChI | InChI=1S/C37H44N6O3/c1-4-45-29-15-16-34(46-5-2)33(24-29)36(44)40-28-13-11-26(12-14-28)32-23-27-25-39-37(41-35(27)31-10-7-6-9-30(31)32)38-17-8-18-43-21-19-42(3)20-22-43/h6-7,9-16,24-25,32H,4-5,8,17-23H2,1-3H3,(H,40,44)(H,38,39,41) |
| InChIKey | ZLKLOZUDADYGTG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|