C34H38BrN7O — CID 59489861
1-(4-bromo-3-methylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea (PubChem CID 59489861) has the molecular formula C34H38BrN7O and a molecular weight of 640.63 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
|---|---|
| PubChem CID | 59489861 |
| Molecular Formula | C34H38BrN7O |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 639.23 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-[4-[2-[3-(4-methylpiperazin-1-yl)propylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(C3Cc4cnc(NCCCN5CCN(C)CC5)nc4-c4ccccc43)cc2)ccc1Br |
| InChI | InChI=1S/C34H38BrN7O/c1-23-20-27(12-13-31(23)35)39-34(43)38-26-10-8-24(9-11-26)30-21-25-22-37-33(40-32(25)29-7-4-3-6-28(29)30)36-14-5-15-42-18-16-41(2)17-19-42/h3-4,6-13,20,22,30H,5,14-19,21H2,1-2H3,(H,36,37,40)(H2,38,39,43) |
| InChIKey | QPRBSUJLLSAOLK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|