C36H41N5O — CID 59489637
4-tert-butyl-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide (PubChem CID 59489637) has the molecular formula C36H41N5O and a molecular weight of 559.76 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 59489637 |
| Molecular Formula | C36H41N5O |
| Molecular Weight | 559.76 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | 4-tert-butyl-N-[4-[2-(3-pyrrolidin-1-ylpropylamino)-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C3Cc4cnc(NCCCN5CCCC5)nc4-c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C36H41N5O/c1-36(2,3)28-15-11-26(12-16-28)34(42)39-29-17-13-25(14-18-29)32-23-27-24-38-35(37-19-8-22-41-20-6-7-21-41)40-33(27)31-10-5-4-9-30(31)32/h4-5,9-18,24,32H,6-8,19-23H2,1-3H3,(H,39,42)(H,37,38,40) |
| InChIKey | OFQIKSKFQMZZJF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.76 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|