C31H31F2N5O — CID 59490079
N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-2,5-difluorobenzamide (PubChem CID 59490079) has the molecular formula C31H31F2N5O and a molecular weight of 527.62 g/mol. Its IUPAC name is N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 59490079 |
| Molecular Formula | C31H31F2N5O |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | N-[4-[2-[4-(dimethylamino)butylamino]-5,6-dihydrobenzo[h]quinazolin-6-yl]phenyl]-2,5-difluorobenzamide |
| SMILES | CN(C)CCCCNc1ncc2c(n1)-c1ccccc1C(c1ccc(NC(=O)c3cc(F)ccc3F)cc1)C2 |
| InChI | InChI=1S/C31H31F2N5O/c1-38(2)16-6-5-15-34-31-35-19-21-17-26(24-7-3-4-8-25(24)29(21)37-31)20-9-12-23(13-10-20)36-30(39)27-18-22(32)11-14-28(27)33/h3-4,7-14,18-19,26H,5-6,15-17H2,1-2H3,(H,36,39)(H,34,35,37) |
| InChIKey | YBUJODZJHVAMDK-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|