C13H10O5 — CID 141273895
2-(2,3-dihydroxyphenyl)-4-hydroxybenzoic acid (PubChem CID 141273895) has the molecular formula C13H10O5 and a molecular weight of 246.22 g/mol. Its IUPAC name is 2-(2,3-dihydroxyphenyl)-4-hydroxybenzoic acid.
| Compound Name | 2-(2,3-dihydroxyphenyl)-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 141273895 |
| Molecular Formula | C13H10O5 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-(2,3-dihydroxyphenyl)-4-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(O)cc1-c1cccc(O)c1O |
| InChI | InChI=1S/C13H10O5/c14-7-4-5-9(13(17)18)10(6-7)8-2-1-3-11(15)12(8)16/h1-6,14-16H,(H,17,18) |
| InChIKey | MPNLNZZSEAZVSC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|