C12H13N3O6S — CID 141273932
4-(5-methoxycarbonyl-3-nitro-2-pyridinyl)thiomorpholine-3-carboxylic acid (PubChem CID 141273932) has the molecular formula C12H13N3O6S and a molecular weight of 327.32 g/mol. Its IUPAC name is 4-(5-methoxycarbonyl-3-nitro-2-pyridinyl)thiomorpholine-3-carboxylic acid.
| Compound Name | 4-(5-methoxycarbonyl-3-nitro-2-pyridinyl)thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 141273932 |
| Molecular Formula | C12H13N3O6S |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 4-(5-methoxycarbonyl-3-nitro-2-pyridinyl)thiomorpholine-3-carboxylic acid |
| SMILES | COC(=O)c1cnc(N2CCSCC2C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O6S/c1-21-12(18)7-4-8(15(19)20)10(13-5-7)14-2-3-22-6-9(14)11(16)17/h4-5,9H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | ZGEKKMFKRIQUTN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|