C16H15N3O4S — CID 166222078
methyl 6-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-5-nitropyridine-3-carboxylate (PubChem CID 166222078) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is methyl 6-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-5-nitropyridine-3-carboxylate.
| Compound Name | methyl 6-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 166222078 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | methyl 6-(3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-5-nitropyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCSc3ccccc3C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N3O4S/c1-23-16(20)12-8-13(19(21)22)15(17-9-12)18-6-7-24-14-5-3-2-4-11(14)10-18/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | WDAQMOMPBISIDZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|