C17H18N8O2 — CID 141276038
5-nitro-6-piperidin-1-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]pyrimidin-4-amine (PubChem CID 141276038) has the molecular formula C17H18N8O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 5-nitro-6-piperidin-1-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 5-nitro-6-piperidin-1-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 141276038 |
| Molecular Formula | C17H18N8O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5-nitro-6-piperidin-1-yl-N-[4-(1,2,4-triazol-1-yl)phenyl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(-n3cncn3)cc2)ncnc1N1CCCCC1 |
| InChI | InChI=1S/C17H18N8O2/c26-25(27)15-16(19-11-20-17(15)23-8-2-1-3-9-23)22-13-4-6-14(7-5-13)24-12-18-10-21-24/h4-7,10-12H,1-3,8-9H2,(H,19,20,22) |
| InChIKey | DPPRWHSIRVFFDO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 114.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|