C24H18Br2N2 — CID 141276562
1-N,4-N-bis(4-bromophenyl)-2-phenylbenzene-1,4-diamine (PubChem CID 141276562) has the molecular formula C24H18Br2N2 and a molecular weight of 494.23 g/mol. Its IUPAC name is 1-N,4-N-bis(4-bromophenyl)-2-phenylbenzene-1,4-diamine.
| Compound Name | 1-N,4-N-bis(4-bromophenyl)-2-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 141276562 |
| Molecular Formula | C24H18Br2N2 |
| Molecular Weight | 494.23 g/mol |
| Exact Mass | 491.98 |
| IUPAC Name | 1-N,4-N-bis(4-bromophenyl)-2-phenylbenzene-1,4-diamine |
| SMILES | Brc1ccc(Nc2ccc(Nc3ccc(Br)cc3)c(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H18Br2N2/c25-18-6-10-20(11-7-18)27-22-14-15-24(28-21-12-8-19(26)9-13-21)23(16-22)17-4-2-1-3-5-17/h1-16,27-28H |
| InChIKey | MUDNGPKFKCTRSF-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.23 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |