C15H13ClN2OS — CID 141277389
3-(1-chlorocyclopropyl)-5-(2,5-dimethylphenoxy)-1,2-thiazole-4-carbonitrile (PubChem CID 141277389) has the molecular formula C15H13ClN2OS and a molecular weight of 304.80 g/mol. Its IUPAC name is 3-(1-chlorocyclopropyl)-5-(2,5-dimethylphenoxy)-1,2-thiazole-4-carbonitrile.
| Compound Name | 3-(1-chlorocyclopropyl)-5-(2,5-dimethylphenoxy)-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 141277389 |
| Molecular Formula | C15H13ClN2OS |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 3-(1-chlorocyclopropyl)-5-(2,5-dimethylphenoxy)-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1ccc(C)c(Oc2snc(C3(Cl)CC3)c2C#N)c1 |
| InChI | InChI=1S/C15H13ClN2OS/c1-9-3-4-10(2)12(7-9)19-14-11(8-17)13(18-20-14)15(16)5-6-15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | RKEOQLHWELMEHB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|