C19H16ClN3OS — CID 58283715
5-(4-amino-2,5-dimethylphenoxy)-3-[(4-chlorophenyl)methyl]-1,2-thiazole-4-carbonitrile (PubChem CID 58283715) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 5-(4-amino-2,5-dimethylphenoxy)-3-[(4-chlorophenyl)methyl]-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-(4-amino-2,5-dimethylphenoxy)-3-[(4-chlorophenyl)methyl]-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 58283715 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-(4-amino-2,5-dimethylphenoxy)-3-[(4-chlorophenyl)methyl]-1,2-thiazole-4-carbonitrile |
| SMILES | Cc1cc(Oc2snc(Cc3ccc(Cl)cc3)c2C#N)c(C)cc1N |
| InChI | InChI=1S/C19H16ClN3OS/c1-11-8-18(12(2)7-16(11)22)24-19-15(10-21)17(23-25-19)9-13-3-5-14(20)6-4-13/h3-8H,9,22H2,1-2H3 |
| InChIKey | BRAZDAQONBLXOH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|