C12H16Cl2N4O4S — CID 141277841
N-(1-carbamoylsulfonylpiperidin-4-yl)-3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamide (PubChem CID 141277841) has the molecular formula C12H16Cl2N4O4S and a molecular weight of 383.26 g/mol. Its IUPAC name is N-(1-carbamoylsulfonylpiperidin-4-yl)-3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(1-carbamoylsulfonylpiperidin-4-yl)-3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 141277841 |
| Molecular Formula | C12H16Cl2N4O4S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | N-(1-carbamoylsulfonylpiperidin-4-yl)-3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamide |
| SMILES | Cc1[nH]c(C(=O)NC2CCN(S(=O)(=O)C(N)=O)CC2)c(Cl)c1Cl |
| InChI | InChI=1S/C12H16Cl2N4O4S/c1-6-8(13)9(14)10(16-6)11(19)17-7-2-4-18(5-3-7)23(21,22)12(15)20/h7,16H,2-5H2,1H3,(H2,15,20)(H,17,19) |
| InChIKey | SOELMBQROISDPW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|