About 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide
2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide (PubChem CID 141277958) has the molecular formula C10H11N3O2S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide.
Molecular Properties
| Compound Name | 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide |
| PubChem CID | 141277958 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide |
| SMILES | Cc1cc(-c2nc(C)c(CC(N)=O)s2)no1 |
| InChI | InChI=1S/C10H11N3O2S/c1-5-3-7(13-15-5)10-12-6(2)8(16-10)4-9(11)14/h3H,4H2,1-2H3,(H2,11,14) |
| InChIKey | SHUNQMPNPFYFMI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide?
The IUPAC name of 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide (CID 141277958) is 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide.
What is the SMILES notation for 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide?
The canonical SMILES for 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide is Cc1cc(-c2nc(C)c(CC(N)=O)s2)no1.
What is the InChIKey of 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide?
The InChIKey is SHUNQMPNPFYFMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c1-5-3-7(13-15-5)10-12-6(2)8(16-10)4-9(11)14/h3H,4H2,1-2H3,(H2,11,14).
What are the key properties of 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide?
2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide has a molecular weight of 237.28 g/mol, XLogP of 1.44, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-methyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-5-yl]acetamide is sourced from PubChem (CID 141277958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).