C17H38N2 — CID 141278434
5,5-dimethyl-6,6-dipropylnonane-4,4-diamine (PubChem CID 141278434) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 5,5-dimethyl-6,6-dipropylnonane-4,4-diamine.
| Compound Name | 5,5-dimethyl-6,6-dipropylnonane-4,4-diamine |
|---|---|
| PubChem CID | 141278434 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 5,5-dimethyl-6,6-dipropylnonane-4,4-diamine |
| SMILES | CCCC(N)(N)C(C)(C)C(CCC)(CCC)CCC |
| InChI | InChI=1S/C17H38N2/c1-7-11-16(12-8-2,13-9-3)15(5,6)17(18,19)14-10-4/h7-14,18-19H2,1-6H3 |
| InChIKey | QWJSRTNEHRCPFE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|