C19H46N2 — CID 159841481
5,5-dimethylnonane;bis(2-methylpropan-2-amine) (PubChem CID 159841481) has the molecular formula C19H46N2 and a molecular weight of 302.59 g/mol. Its IUPAC name is 5,5-dimethylnonane;bis(2-methylpropan-2-amine).
| Compound Name | 5,5-dimethylnonane;bis(2-methylpropan-2-amine) |
|---|---|
| PubChem CID | 159841481 |
| Molecular Formula | C19H46N2 |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 302.37 |
| IUPAC Name | 5,5-dimethylnonane;bis(2-methylpropan-2-amine) |
| SMILES | CC(C)(C)N.CC(C)(C)N.CCCCC(C)(C)CCCC |
| InChI | InChI=1S/C11H24.2C4H11N/c1-5-7-9-11(3,4)10-8-6-2;2*1-4(2,3)5/h5-10H2,1-4H3;2*5H2,1-3H3 |
| InChIKey | NOSQCLWLUXZBRZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |