C8H8IN3 — CID 141280112
4-(2-iodophenyl)-1,5-dihydro-1,2,4-triazole (PubChem CID 141280112) has the molecular formula C8H8IN3 and a molecular weight of 273.08 g/mol. Its IUPAC name is 4-(2-iodophenyl)-1,5-dihydro-1,2,4-triazole.
| Compound Name | 4-(2-iodophenyl)-1,5-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 141280112 |
| Molecular Formula | C8H8IN3 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 4-(2-iodophenyl)-1,5-dihydro-1,2,4-triazole |
| SMILES | Ic1ccccc1N1C=NNC1 |
| InChI | InChI=1S/C8H8IN3/c9-7-3-1-2-4-8(7)12-5-10-11-6-12/h1-5,11H,6H2 |
| InChIKey | KDOSJKDMCQAPBU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|