C5H14BrNO2 — CID 141281383
2,2-dihydroxyethyl-ethyl-methylazanium bromide (PubChem CID 141281383) has the molecular formula C5H14BrNO2 and a molecular weight of 200.08 g/mol. Its IUPAC name is 2,2-dihydroxyethyl-ethyl-methylazanium bromide.
| Compound Name | 2,2-dihydroxyethyl-ethyl-methylazanium bromide |
|---|---|
| PubChem CID | 141281383 |
| Molecular Formula | C5H14BrNO2 |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 2,2-dihydroxyethyl-ethyl-methylazanium bromide |
| SMILES | CC[NH+](C)CC(O)O.[Br-] |
| InChI | InChI=1S/C5H13NO2.BrH/c1-3-6(2)4-5(7)8;/h5,7-8H,3-4H2,1-2H3;1H |
| InChIKey | LBCQSUKJNKECOT-UHFFFAOYSA-N |
| XLogP | -5.16 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | -5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|