C20H45NO — CID 141282397
5,5-diethylheptan-3-yl(tripropyl)azanium hydroxide (PubChem CID 141282397) has the molecular formula C20H45NO and a molecular weight of 315.59 g/mol. Its IUPAC name is 5,5-diethylheptan-3-yl(tripropyl)azanium hydroxide.
| Compound Name | 5,5-diethylheptan-3-yl(tripropyl)azanium hydroxide |
|---|---|
| PubChem CID | 141282397 |
| Molecular Formula | C20H45NO |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 315.35 |
| IUPAC Name | 5,5-diethylheptan-3-yl(tripropyl)azanium hydroxide |
| SMILES | CCC[N+](CCC)(CCC)C(CC)CC(CC)(CC)CC.[OH-] |
| InChI | InChI=1S/C20H44N.H2O/c1-8-15-21(16-9-2,17-10-3)19(11-4)18-20(12-5,13-6)14-7;/h19H,8-18H2,1-7H3;1H2/q+1;/p-1 |
| InChIKey | TXCKCFJAUVZTMN-UHFFFAOYSA-M |
| XLogP | 6.24 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|