C19H22F17IN2 — CID 141282735
3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-hexyl-1,2-dihydroimidazol-1-ium iodide (PubChem CID 141282735) has the molecular formula C19H22F17IN2 and a molecular weight of 728.27 g/mol. Its IUPAC name is 3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-hexyl-1,2-dihydroimidazol-1-ium iodide.
| Compound Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-hexyl-1,2-dihydroimidazol-1-ium iodide |
|---|---|
| PubChem CID | 141282735 |
| Molecular Formula | C19H22F17IN2 |
| Molecular Weight | 728.27 g/mol |
| Exact Mass | 728.06 |
| IUPAC Name | 3-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-1-hexyl-1,2-dihydroimidazol-1-ium iodide |
| SMILES | CCCCCC[NH+]1C=CN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1.[I-] |
| InChI | InChI=1S/C19H21F17N2.HI/c1-2-3-4-5-7-37-9-10-38(11-37)8-6-12(20,21)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36;/h9-10H,2-8,11H2,1H3;1H |
| InChIKey | YAOYBJZYFTVJIP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|