C31H47NO2 — CID 141284600
(2,4-dioctylphenyl) N-(2,4-dimethylphenyl)carbamate (PubChem CID 141284600) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is (2,4-dioctylphenyl) N-(2,4-dimethylphenyl)carbamate.
| Compound Name | (2,4-dioctylphenyl) N-(2,4-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 141284600 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | (2,4-dioctylphenyl) N-(2,4-dimethylphenyl)carbamate |
| SMILES | CCCCCCCCc1ccc(OC(=O)Nc2ccc(C)cc2C)c(CCCCCCCC)c1 |
| InChI | InChI=1S/C31H47NO2/c1-5-7-9-11-13-15-17-27-20-22-30(28(24-27)18-16-14-12-10-8-6-2)34-31(33)32-29-21-19-25(3)23-26(29)4/h19-24H,5-18H2,1-4H3,(H,32,33) |
| InChIKey | YKOAIXQCNJQIIU-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|