C28H18Cl4O4 — CID 141286258
(2-benzyl-3,4-dichlorobenzoyl) 2-benzyl-3,4-dichlorobenzenecarboperoxoate (PubChem CID 141286258) has the molecular formula C28H18Cl4O4 and a molecular weight of 560.26 g/mol. Its IUPAC name is (2-benzyl-3,4-dichlorobenzoyl) 2-benzyl-3,4-dichlorobenzenecarboperoxoate.
| Compound Name | (2-benzyl-3,4-dichlorobenzoyl) 2-benzyl-3,4-dichlorobenzenecarboperoxoate |
|---|---|
| PubChem CID | 141286258 |
| Molecular Formula | C28H18Cl4O4 |
| Molecular Weight | 560.26 g/mol |
| Exact Mass | 558.00 |
| IUPAC Name | (2-benzyl-3,4-dichlorobenzoyl) 2-benzyl-3,4-dichlorobenzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1ccc(Cl)c(Cl)c1Cc1ccccc1)c1ccc(Cl)c(Cl)c1Cc1ccccc1 |
| InChI | InChI=1S/C28H18Cl4O4/c29-23-13-11-19(21(25(23)31)15-17-7-3-1-4-8-17)27(33)35-36-28(34)20-12-14-24(30)26(32)22(20)16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
| InChIKey | GMVIJXHSADFLPY-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.26 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|