C20H21FN2O2S — CID 141287256
tert-butyl N-[(1R)-1-[4-(1-benzothiophen-7-yl)-6-fluoro-3-pyridinyl]ethyl]carbamate (PubChem CID 141287256) has the molecular formula C20H21FN2O2S and a molecular weight of 372.47 g/mol. Its IUPAC name is tert-butyl N-[(1R)-1-[4-(1-benzothiophen-7-yl)-6-fluoro-3-pyridinyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1R)-1-[4-(1-benzothiophen-7-yl)-6-fluoro-3-pyridinyl]ethyl]carbamate |
|---|---|
| PubChem CID | 141287256 |
| Molecular Formula | C20H21FN2O2S |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | tert-butyl N-[(1R)-1-[4-(1-benzothiophen-7-yl)-6-fluoro-3-pyridinyl]ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OC(C)(C)C)c1cnc(F)cc1-c1cccc2ccsc12 |
| InChI | InChI=1S/C20H21FN2O2S/c1-12(23-19(24)25-20(2,3)4)16-11-22-17(21)10-15(16)14-7-5-6-13-8-9-26-18(13)14/h5-12H,1-4H3,(H,23,24)/t12-/m1/s1 |
| InChIKey | XWZDZWSBOHKJJF-GFCCVEGCSA-N |
| XLogP | 5.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|