C17H21N3O3S — CID 141287527
N-methyl-N-[4-[(pyridin-3-ylsulfonylamino)methyl]phenyl]butanamide (PubChem CID 141287527) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-methyl-N-[4-[(pyridin-3-ylsulfonylamino)methyl]phenyl]butanamide.
| Compound Name | N-methyl-N-[4-[(pyridin-3-ylsulfonylamino)methyl]phenyl]butanamide |
|---|---|
| PubChem CID | 141287527 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-methyl-N-[4-[(pyridin-3-ylsulfonylamino)methyl]phenyl]butanamide |
| SMILES | CCCC(=O)N(C)c1ccc(CNS(=O)(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-3-5-17(21)20(2)15-9-7-14(8-10-15)12-19-24(22,23)16-6-4-11-18-13-16/h4,6-11,13,19H,3,5,12H2,1-2H3 |
| InChIKey | BZTXRPDXVDBUMM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |