C17H28FNOSi — CID 141292504
2,2-dimethylpropyl-[(3R,5R)-5-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane (PubChem CID 141292504) has the molecular formula C17H28FNOSi and a molecular weight of 309.50 g/mol. Its IUPAC name is 2,2-dimethylpropyl-[(3R,5R)-5-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane.
| Compound Name | 2,2-dimethylpropyl-[(3R,5R)-5-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 141292504 |
| Molecular Formula | C17H28FNOSi |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2,2-dimethylpropyl-[(3R,5R)-5-(3-fluorophenyl)pyrrolidin-3-yl]oxy-dimethylsilane |
| SMILES | CC(C)(C)C[Si](C)(C)O[C@H]1CN[C@@H](c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H28FNOSi/c1-17(2,3)12-21(4,5)20-15-10-16(19-11-15)13-7-6-8-14(18)9-13/h6-9,15-16,19H,10-12H2,1-5H3/t15-,16-/m1/s1 |
| InChIKey | FCVLMPHIZVKASA-HZPDHXFCSA-N |
| XLogP | 4.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|