C15H18N2O3 — CID 141292883
N-[(2S)-1-(hydroxyamino)-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide (PubChem CID 141292883) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(2S)-1-(hydroxyamino)-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide.
| Compound Name | N-[(2S)-1-(hydroxyamino)-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 141292883 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(2S)-1-(hydroxyamino)-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C1=C2C=CC=C2C=C1)C(=O)NO |
| InChI | InChI=1S/C15H18N2O3/c1-15(2,3)12(14(19)17-20)16-13(18)11-8-7-9-5-4-6-10(9)11/h4-8,12,20H,1-3H3,(H,16,18)(H,17,19)/t12-/m1/s1 |
| InChIKey | UCJDJTAKUWPSTF-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|