C16H20N2O3 — CID 158337034
N-[(2S)-1-[hydroxy(methyl)amino]-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide (PubChem CID 158337034) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-[(2S)-1-[hydroxy(methyl)amino]-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide.
| Compound Name | N-[(2S)-1-[hydroxy(methyl)amino]-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 158337034 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-[(2S)-1-[hydroxy(methyl)amino]-3,3-dimethyl-1-oxobutan-2-yl]pentalene-1-carboxamide |
| SMILES | CN(O)C(=O)[C@@H](NC(=O)C1=C2C=CC=C2C=C1)C(C)(C)C |
| InChI | InChI=1S/C16H20N2O3/c1-16(2,3)13(15(20)18(4)21)17-14(19)12-9-8-10-6-5-7-11(10)12/h5-9,13,21H,1-4H3,(H,17,19)/t13-/m1/s1 |
| InChIKey | GQSAVZUQCSULAR-CYBMUJFWSA-N |
| XLogP | 1.73 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|