C15H18FNO — CID 141293074
N-[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]pentalene-1-carboxamide (PubChem CID 141293074) has the molecular formula C15H18FNO and a molecular weight of 247.31 g/mol. Its IUPAC name is N-[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]pentalene-1-carboxamide.
| Compound Name | N-[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]pentalene-1-carboxamide |
|---|---|
| PubChem CID | 141293074 |
| Molecular Formula | C15H18FNO |
| Molecular Weight | 247.31 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[(2S)-1-fluoro-3,3-dimethylbutan-2-yl]pentalene-1-carboxamide |
| SMILES | CC(C)(C)[C@@H](CF)NC(=O)C1=CC=C2C=CC=C21 |
| InChI | InChI=1S/C15H18FNO/c1-15(2,3)13(9-16)17-14(18)12-8-7-10-5-4-6-11(10)12/h4-8,13H,9H2,1-3H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | LPIMEAULUDMSLB-CYBMUJFWSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |